C15H16OS3 — CID 10804769
S-methyl 2,2-bis(methylsulfanyl)-2-naphthalen-2-ylethanethioate (PubChem CID 10804769) has the molecular formula C15H16OS3 and a molecular weight of 308.49 g/mol. Its IUPAC name is S-methyl 2,2-bis(methylsulfanyl)-2-naphthalen-2-ylethanethioate.
| Compound Name | S-methyl 2,2-bis(methylsulfanyl)-2-naphthalen-2-ylethanethioate |
|---|---|
| PubChem CID | 10804769 |
| Molecular Formula | C15H16OS3 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | S-methyl 2,2-bis(methylsulfanyl)-2-naphthalen-2-ylethanethioate |
| SMILES | CSC(=O)C(SC)(SC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16OS3/c1-17-14(16)15(18-2,19-3)13-9-8-11-6-4-5-7-12(11)10-13/h4-10H,1-3H3 |
| InChIKey | IODBNTMULUDAGS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|