C12H16O2S3 — CID 10637130
S-methyl 2-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethanethioate (PubChem CID 10637130) has the molecular formula C12H16O2S3 and a molecular weight of 288.46 g/mol. Its IUPAC name is S-methyl 2-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethanethioate.
| Compound Name | S-methyl 2-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethanethioate |
|---|---|
| PubChem CID | 10637130 |
| Molecular Formula | C12H16O2S3 |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | S-methyl 2-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethanethioate |
| SMILES | COc1ccc(C(SC)(SC)C(=O)SC)cc1 |
| InChI | InChI=1S/C12H16O2S3/c1-14-10-7-5-9(6-8-10)12(16-3,17-4)11(13)15-2/h5-8H,1-4H3 |
| InChIKey | NBPAOROXUKZNRG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|