C16H13BrF3NO — CID 138964215
2-bromo-4,4,4-trifluoro-N,2-diphenylbutanamide (PubChem CID 138964215) has the molecular formula C16H13BrF3NO and a molecular weight of 372.18 g/mol. Its IUPAC name is 2-bromo-4,4,4-trifluoro-N,2-diphenylbutanamide.
| Compound Name | 2-bromo-4,4,4-trifluoro-N,2-diphenylbutanamide |
|---|---|
| PubChem CID | 138964215 |
| Molecular Formula | C16H13BrF3NO |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2-bromo-4,4,4-trifluoro-N,2-diphenylbutanamide |
| SMILES | O=C(Nc1ccccc1)C(Br)(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H13BrF3NO/c17-15(11-16(18,19)20,12-7-3-1-4-8-12)14(22)21-13-9-5-2-6-10-13/h1-10H,11H2,(H,21,22) |
| InChIKey | ANZKPZCBXPFNED-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|