C8H6FN3O5 — CID 150962851
2-fluoro-2,2-dinitro-N-phenylacetamide (PubChem CID 150962851) has the molecular formula C8H6FN3O5 and a molecular weight of 243.15 g/mol. Its IUPAC name is 2-fluoro-2,2-dinitro-N-phenylacetamide.
| Compound Name | 2-fluoro-2,2-dinitro-N-phenylacetamide |
|---|---|
| PubChem CID | 150962851 |
| Molecular Formula | C8H6FN3O5 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-fluoro-2,2-dinitro-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H6FN3O5/c9-8(11(14)15,12(16)17)7(13)10-6-4-2-1-3-5-6/h1-5H,(H,10,13) |
| InChIKey | LMLUQRNTRKDKHH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|