C17H15F4NO — CID 164686623
(2R)-4,4,4-trifluoro-2-(2-fluorophenyl)-2-methyl-N-phenylbutanamide (PubChem CID 164686623) has the molecular formula C17H15F4NO and a molecular weight of 325.31 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-(2-fluorophenyl)-2-methyl-N-phenylbutanamide.
| Compound Name | (2R)-4,4,4-trifluoro-2-(2-fluorophenyl)-2-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 164686623 |
| Molecular Formula | C17H15F4NO |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-(2-fluorophenyl)-2-methyl-N-phenylbutanamide |
| SMILES | C[C@](CC(F)(F)F)(C(=O)Nc1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C17H15F4NO/c1-16(11-17(19,20)21,13-9-5-6-10-14(13)18)15(23)22-12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | PSVBXGGCVFKWIY-MRXNPFEDSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |