C19H35NOS — CID 145483758
ethane;2,2,4-trimethyl-4-methylsulfanyl-N-phenylpentanamide (PubChem CID 145483758) has the molecular formula C19H35NOS and a molecular weight of 325.56 g/mol. Its IUPAC name is ethane;2,2,4-trimethyl-4-methylsulfanyl-N-phenylpentanamide.
| Compound Name | ethane;2,2,4-trimethyl-4-methylsulfanyl-N-phenylpentanamide |
|---|---|
| PubChem CID | 145483758 |
| Molecular Formula | C19H35NOS |
| Molecular Weight | 325.56 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | ethane;2,2,4-trimethyl-4-methylsulfanyl-N-phenylpentanamide |
| SMILES | CC.CC.CSC(C)(C)CC(C)(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H23NOS.2C2H6/c1-14(2,11-15(3,4)18-5)13(17)16-12-9-7-6-8-10-12;2*1-2/h6-10H,11H2,1-5H3,(H,16,17);2*1-2H3 |
| InChIKey | QJZYNCDNZOIZMK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |