C22H17BrF3NO — CID 138964155
(2S)-2-(4-bromophenyl)-4,4,4-trifluoro-N,2-diphenylbutanamide (PubChem CID 138964155) has the molecular formula C22H17BrF3NO and a molecular weight of 448.28 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-4,4,4-trifluoro-N,2-diphenylbutanamide.
| Compound Name | (2S)-2-(4-bromophenyl)-4,4,4-trifluoro-N,2-diphenylbutanamide |
|---|---|
| PubChem CID | 138964155 |
| Molecular Formula | C22H17BrF3NO |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-4,4,4-trifluoro-N,2-diphenylbutanamide |
| SMILES | O=C(Nc1ccccc1)[C@@](CC(F)(F)F)(c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H17BrF3NO/c23-18-13-11-17(12-14-18)21(15-22(24,25)26,16-7-3-1-4-8-16)20(28)27-19-9-5-2-6-10-19/h1-14H,15H2,(H,27,28)/t21-/m0/s1 |
| InChIKey | OIADCDNUQXXLBE-NRFANRHFSA-N |
| XLogP | 6.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |