C20H19N3O2 — CID 139899649
2,2-bis(4-aminophenyl)-2-hydroxy-N-phenylacetamide (PubChem CID 139899649) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2,2-bis(4-aminophenyl)-2-hydroxy-N-phenylacetamide.
| Compound Name | 2,2-bis(4-aminophenyl)-2-hydroxy-N-phenylacetamide |
|---|---|
| PubChem CID | 139899649 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2,2-bis(4-aminophenyl)-2-hydroxy-N-phenylacetamide |
| SMILES | Nc1ccc(C(O)(C(=O)Nc2ccccc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C20H19N3O2/c21-16-10-6-14(7-11-16)20(25,15-8-12-17(22)13-9-15)19(24)23-18-4-2-1-3-5-18/h1-13,25H,21-22H2,(H,23,24) |
| InChIKey | KUXIUJAXHQHZAM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|