C20H16FNO2 — CID 693053
N-(4-fluorophenyl)-2-hydroxy-2,2-diphenylacetamide (PubChem CID 693053) has the molecular formula C20H16FNO2 and a molecular weight of 321.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 693053 |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16FNO2/c21-17-11-13-18(14-12-17)22-19(23)20(24,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,24H,(H,22,23) |
| InChIKey | ZUQHVMOXVLNALX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |