C21H18ClN3O3 — CID 4130294
1-(4-chlorophenyl)-3-[(2-hydroxy-2,2-diphenylacetyl)amino]urea (PubChem CID 4130294) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2-hydroxy-2,2-diphenylacetyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2-hydroxy-2,2-diphenylacetyl)amino]urea |
|---|---|
| PubChem CID | 4130294 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2-hydroxy-2,2-diphenylacetyl)amino]urea |
| SMILES | O=C(NNC(=O)C(O)(c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClN3O3/c22-17-11-13-18(14-12-17)23-20(27)25-24-19(26)21(28,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,28H,(H,24,26)(H2,23,25,27) |
| InChIKey | NOXQHMXCBUFKPN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|