C8H5Br3ClNO — CID 10916515
2,2,2-tribromo-N-(4-chlorophenyl)acetamide (PubChem CID 10916515) has the molecular formula C8H5Br3ClNO and a molecular weight of 406.30 g/mol. Its IUPAC name is 2,2,2-tribromo-N-(4-chlorophenyl)acetamide.
| Compound Name | 2,2,2-tribromo-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 10916515 |
| Molecular Formula | C8H5Br3ClNO |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 402.76 |
| IUPAC Name | 2,2,2-tribromo-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(Br)(Br)Br |
| InChI | InChI=1S/C8H5Br3ClNO/c9-8(10,11)7(14)13-6-3-1-5(12)2-4-6/h1-4H,(H,13,14) |
| InChIKey | UDEXFWRXILHWLA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|