C7H5Br3N2O — CID 23576873
2,2,2-tribromo-N-pyridin-4-ylacetamide (PubChem CID 23576873) has the molecular formula C7H5Br3N2O and a molecular weight of 372.84 g/mol. Its IUPAC name is 2,2,2-tribromo-N-pyridin-4-ylacetamide.
| Compound Name | 2,2,2-tribromo-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 23576873 |
| Molecular Formula | C7H5Br3N2O |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 369.80 |
| IUPAC Name | 2,2,2-tribromo-N-pyridin-4-ylacetamide |
| SMILES | O=C(Nc1ccncc1)C(Br)(Br)Br |
| InChI | InChI=1S/C7H5Br3N2O/c8-7(9,10)6(13)12-5-1-3-11-4-2-5/h1-4H,(H,11,12,13) |
| InChIKey | URRXYASFAYRDSE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|