C11H13N3O — CID 114291006
2-cyano-2-methyl-N-pyridin-4-ylbutanamide (PubChem CID 114291006) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-cyano-2-methyl-N-pyridin-4-ylbutanamide.
| Compound Name | 2-cyano-2-methyl-N-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 114291006 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-cyano-2-methyl-N-pyridin-4-ylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C11H13N3O/c1-3-11(2,8-12)10(15)14-9-4-6-13-7-5-9/h4-7H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | PADAEGQGIPQCAY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |