C19H16N2O3 — CID 166340253
2-hydroxy-N-(1-oxidopyridin-1-ium-3-yl)-2,2-diphenylacetamide (PubChem CID 166340253) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-hydroxy-N-(1-oxidopyridin-1-ium-3-yl)-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-(1-oxidopyridin-1-ium-3-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 166340253 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-hydroxy-N-(1-oxidopyridin-1-ium-3-yl)-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc[n+]([O-])c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O3/c22-18(20-17-12-7-13-21(24)14-17)19(23,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,23H,(H,20,22) |
| InChIKey | IQQDZNUKXLLJDI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|