C22H21N3O2 — CID 4215253
N-[1-(4-aminophenyl)ethylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 4215253) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[1-(4-aminophenyl)ethylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4215253 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[1-(4-aminophenyl)ethylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CC(=NNC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H21N3O2/c1-16(17-12-14-20(23)15-13-17)24-25-21(26)22(27,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,27H,23H2,1H3,(H,25,26) |
| InChIKey | BAZDIXDBVWUKBZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|