C19H25NO — CID 122214987
4-[(2S,3R)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]benzonitrile (PubChem CID 122214987) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-[(2S,3R)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]benzonitrile.
| Compound Name | 4-[(2S,3R)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]benzonitrile |
|---|---|
| PubChem CID | 122214987 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-[(2S,3R)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]benzonitrile |
| SMILES | C=C[C@@](C)(CCC=C(C)C)[C@](C)(O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H25NO/c1-6-18(4,13-7-8-15(2)3)19(5,21)17-11-9-16(14-20)10-12-17/h6,8-12,21H,1,7,13H2,2-5H3/t18-,19+/m0/s1 |
| InChIKey | WGHDQDGNKCHJCO-RBUKOAKNSA-N |
| XLogP | 4.70 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|