C15H26 — CID 154718981
6-ethenyl-2,6-dimethyl-8-methylidenedec-2-ene (PubChem CID 154718981) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 6-ethenyl-2,6-dimethyl-8-methylidenedec-2-ene.
| Compound Name | 6-ethenyl-2,6-dimethyl-8-methylidenedec-2-ene |
|---|---|
| PubChem CID | 154718981 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 6-ethenyl-2,6-dimethyl-8-methylidenedec-2-ene |
| SMILES | C=CC(C)(CCC=C(C)C)CC(=C)CC |
| InChI | InChI=1S/C15H26/c1-7-14(5)12-15(6,8-2)11-9-10-13(3)4/h8,10H,2,5,7,9,11-12H2,1,3-4,6H3 |
| InChIKey | XYEOGANAKHJRHK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|