C24H40O4 — CID 174495173
(4E)-5,9-dimethyldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyloct-6-enoic acid (PubChem CID 174495173) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is (4E)-5,9-dimethyldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyloct-6-enoic acid.
| Compound Name | (4E)-5,9-dimethyldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyloct-6-enoic acid |
|---|---|
| PubChem CID | 174495173 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | (4E)-5,9-dimethyldeca-4,8-dienoic acid;3-ethenyl-3,7-dimethyloct-6-enoic acid |
| SMILES | C=CC(C)(CCC=C(C)C)CC(=O)O.CC(C)=CCC/C(C)=C/CCC(=O)O |
| InChI | InChI=1S/2C12H20O2/c1-10(2)6-4-7-11(3)8-5-9-12(13)14;1-5-12(4,9-11(13)14)8-6-7-10(2)3/h6,8H,4-5,7,9H2,1-3H3,(H,13,14);5,7H,1,6,8-9H2,2-4H3,(H,13,14)/b11-8+; |
| InChIKey | ZPHGPVOQUDSPMK-YGCVIUNWSA-N |
| XLogP | 6.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|