C33H54O3 — CID 176897325
(4E,8E,12E,16E,20E)-2-hydroxy-2,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaenoic acid (PubChem CID 176897325) has the molecular formula C33H54O3 and a molecular weight of 498.79 g/mol. Its IUPAC name is (4E,8E,12E,16E,20E)-2-hydroxy-2,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaenoic acid.
| Compound Name | (4E,8E,12E,16E,20E)-2-hydroxy-2,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaenoic acid |
|---|---|
| PubChem CID | 176897325 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | (4E,8E,12E,16E,20E)-2-hydroxy-2,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaenoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC(C)(O)C(=O)O |
| InChI | InChI=1S/C33H54O3/c1-26(2)15-11-18-29(5)21-12-19-27(3)16-9-10-17-28(4)20-13-22-30(6)23-14-24-31(7)25-33(8,36)32(34)35/h15-17,21-22,24,36H,9-14,18-20,23,25H2,1-8H3,(H,34,35)/b27-16+,28-17+,29-21+,30-22+,31-24+ |
| InChIKey | VNDGETRAVPQNRL-FGFGNNQVSA-N |
| XLogP | 9.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|