C19H33O6P — CID 54070061
2-hydroxy-7,11,15-trimethyl-2-phosphonohexadeca-6,10,14-trienoic acid (PubChem CID 54070061) has the molecular formula C19H33O6P and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-hydroxy-7,11,15-trimethyl-2-phosphonohexadeca-6,10,14-trienoic acid.
| Compound Name | 2-hydroxy-7,11,15-trimethyl-2-phosphonohexadeca-6,10,14-trienoic acid |
|---|---|
| PubChem CID | 54070061 |
| Molecular Formula | C19H33O6P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-hydroxy-7,11,15-trimethyl-2-phosphonohexadeca-6,10,14-trienoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCCC(O)(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C19H33O6P/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-19(22,18(20)21)26(23,24)25/h9-10,13,22H,5-8,11-12,14H2,1-4H3,(H,20,21)(H2,23,24,25) |
| InChIKey | MFUMIJMSCQHAKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|