C18H31O4P — CID 11824066
[hydroxy-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphoryl]formic acid (PubChem CID 11824066) has the molecular formula C18H31O4P and a molecular weight of 342.42 g/mol. Its IUPAC name is [hydroxy-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphoryl]formic acid.
| Compound Name | [hydroxy-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphoryl]formic acid |
|---|---|
| PubChem CID | 11824066 |
| Molecular Formula | C18H31O4P |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [hydroxy-[(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-trienyl]phosphoryl]formic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCP(=O)(O)C(=O)O |
| InChI | InChI=1S/C18H31O4P/c1-15(2)9-7-11-17(4)13-8-12-16(3)10-5-6-14-23(21,22)18(19)20/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,19,20)(H,21,22)/b16-10+,17-13+ |
| InChIKey | SFEHHYFEEGGICV-QKXOVSGLSA-N |
| XLogP | 6.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|