C12H24O2 — CID 160907821
3-methylpent-1-en-3-ol;4-methylpent-3-en-1-ol (PubChem CID 160907821) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3-methylpent-1-en-3-ol;4-methylpent-3-en-1-ol.
| Compound Name | 3-methylpent-1-en-3-ol;4-methylpent-3-en-1-ol |
|---|---|
| PubChem CID | 160907821 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3-methylpent-1-en-3-ol;4-methylpent-3-en-1-ol |
| SMILES | C=CC(C)(O)CC.CC(C)=CCCO |
| InChI | InChI=1S/2C6H12O/c1-6(2)4-3-5-7;1-4-6(3,7)5-2/h4,7H,3,5H2,1-2H3;4,7H,1,5H2,2-3H3 |
| InChIKey | SQJKUQXZDKSEPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|