C18H32O4 — CID 10881524
(2S)-2-[(2R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol (PubChem CID 10881524) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (2S)-2-[(2R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol.
| Compound Name | (2S)-2-[(2R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 10881524 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (2S)-2-[(2R,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@](C)(O)[C@H]1CC[C@](C)([C@@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C18H32O4/c1-13(2)8-7-10-17(5,19)14-9-11-18(6,22-14)15-12-20-16(3,4)21-15/h8,14-15,19H,7,9-12H2,1-6H3/t14-,15+,17+,18-/m1/s1 |
| InChIKey | CHFMBHRIWDOGLK-MXSMSXNCSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|