C29H48O2 — CID 167074379
(2S)-6-methyl-2-[(1R,6R,11S)-1,11,15,15-tetramethyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]hept-5-en-2-ol (PubChem CID 167074379) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (2S)-6-methyl-2-[(1R,6R,11S)-1,11,15,15-tetramethyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]hept-5-en-2-ol.
| Compound Name | (2S)-6-methyl-2-[(1R,6R,11S)-1,11,15,15-tetramethyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]hept-5-en-2-ol |
|---|---|
| PubChem CID | 167074379 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (2S)-6-methyl-2-[(1R,6R,11S)-1,11,15,15-tetramethyl-7-oxapentacyclo[8.8.0.02,6.06,8.011,16]octadecan-5-yl]hept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@](C)(O)C1CCC2[C@]3(C)CCC4C(C)(C)CCC[C@]4(C)C3CC3O[C@]321 |
| InChI | InChI=1S/C29H48O2/c1-19(2)10-8-16-28(7,30)22-12-11-21-27(6)17-13-20-25(3,4)14-9-15-26(20,5)23(27)18-24-29(21,22)31-24/h10,20-24,30H,8-9,11-18H2,1-7H3/t20?,21?,22?,23?,24?,26-,27-,28-,29+/m0/s1 |
| InChIKey | QYGLEXGVLOQJBV-YZUCHPSPSA-N |
| XLogP | 7.30 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|