C30H52O2 — CID 11464964
(3R,4R,5aR,7aS,11aS,11bR)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,5a,8,8,11a-pentamethyl-1,2,3,6,7,7a,9,10,11,11b-decahydronaphtho[2,1-b]oxepin-3-ol (PubChem CID 11464964) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (3R,4R,5aR,7aS,11aS,11bR)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,5a,8,8,11a-pentamethyl-1,2,3,6,7,7a,9,10,11,11b-decahydronaphtho[2,1-b]oxepin-3-ol.
| Compound Name | (3R,4R,5aR,7aS,11aS,11bR)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,5a,8,8,11a-pentamethyl-1,2,3,6,7,7a,9,10,11,11b-decahydronaphtho[2,1-b]oxepin-3-ol |
|---|---|
| PubChem CID | 11464964 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (3R,4R,5aR,7aS,11aS,11bR)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,5a,8,8,11a-pentamethyl-1,2,3,6,7,7a,9,10,11,11b-decahydronaphtho[2,1-b]oxepin-3-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@]1(C)O[C@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2CC[C@H]1O |
| InChI | InChI=1S/C30H52O2/c1-22(2)12-9-13-23(3)14-10-20-30(8)26(31)16-15-25-28(6)19-11-18-27(4,5)24(28)17-21-29(25,7)32-30/h12,14,24-26,31H,9-11,13,15-21H2,1-8H3/b23-14+/t24-,25+,26+,28-,29+,30+/m0/s1 |
| InChIKey | ZMDKPBUKEFTRHL-NXTQFOGZSA-N |
| XLogP | 8.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|