C30H52O6 — CID 42599666
(2S)-2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-methyloxolan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol (PubChem CID 42599666) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is (2S)-2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-methyloxolan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol.
| Compound Name | (2S)-2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-methyloxolan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 42599666 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (2S)-2-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2-methyloxolan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@](C)(O)[C@H]1CC[C@@](C)([C@H]2CC[C@@H]([C@@]3(C)CC[C@@H]([C@@]4(C)CC[C@@H](C(C)(C)O)O4)O3)O2)O1 |
| InChI | InChI=1S/C30H52O6/c1-20(2)10-9-16-27(5,32)22-14-18-28(6,35-22)23-11-12-24(33-23)29(7)19-15-25(36-29)30(8)17-13-21(34-30)26(3,4)31/h10,21-25,31-32H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25-,27-,28-,29+,30+/m0/s1 |
| InChIKey | CWOPUWSCSNCMMR-ZRSTZJMUSA-N |
| XLogP | 5.62 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|