C30H54O7 — CID 10649798
(3R)-6-[(2R,5S)-5-[(2R,5R)-5-[(2R,5S,6R)-5-hydroxy-2,6-dimethyl-6-(4-methylpent-3-enyl)oxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol (PubChem CID 10649798) has the molecular formula C30H54O7 and a molecular weight of 526.76 g/mol. Its IUPAC name is (3R)-6-[(2R,5S)-5-[(2R,5R)-5-[(2R,5S,6R)-5-hydroxy-2,6-dimethyl-6-(4-methylpent-3-enyl)oxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol.
| Compound Name | (3R)-6-[(2R,5S)-5-[(2R,5R)-5-[(2R,5S,6R)-5-hydroxy-2,6-dimethyl-6-(4-methylpent-3-enyl)oxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
|---|---|
| PubChem CID | 10649798 |
| Molecular Formula | C30H54O7 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | (3R)-6-[(2R,5S)-5-[(2R,5R)-5-[(2R,5S,6R)-5-hydroxy-2,6-dimethyl-6-(4-methylpent-3-enyl)oxan-2-yl]oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@@](C)([C@H]2CC[C@H]([C@]3(C)CC[C@H](C(C)(O)CC[C@@H](O)C(C)(C)O)O3)O2)CC[C@@H]1O |
| InChI | InChI=1S/C30H54O7/c1-20(2)10-9-16-28(6)22(32)14-18-30(8,37-28)25-12-11-24(35-25)29(7)19-15-23(36-29)27(5,34)17-13-21(31)26(3,4)33/h10,21-25,31-34H,9,11-19H2,1-8H3/t21-,22+,23-,24-,25-,27?,28-,29+,30-/m1/s1 |
| InChIKey | HYTFZPOVUKTRMC-HRCQCJNNSA-N |
| XLogP | 4.57 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|