C16H30O5 — CID 42600161
(3R,6S)-6-[(2R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol (PubChem CID 42600161) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (3R,6S)-6-[(2R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol.
| Compound Name | (3R,6S)-6-[(2R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
|---|---|
| PubChem CID | 42600161 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (3R,6S)-6-[(2R,5S)-5-[(1R)-1-hydroxyprop-2-enyl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
| SMILES | C=C[C@@H](O)[C@]1(C)CC[C@H]([C@@](C)(O)CC[C@@H](O)C(C)(C)O)O1 |
| InChI | InChI=1S/C16H30O5/c1-6-11(17)16(5)10-8-13(21-16)15(4,20)9-7-12(18)14(2,3)19/h6,11-13,17-20H,1,7-10H2,2-5H3/t11-,12-,13-,15+,16+/m1/s1 |
| InChIKey | MNQAQMGHTRNPFS-UVQHHTHUSA-N |
| XLogP | 1.13 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|