C31H55BrO7 — CID 163113866
6-[5-[5-(7-bromo-2,4a,6,6,9a-pentamethyl-4,7,8,9-tetrahydro-3H-pyrano[3,2-b]oxepin-2-yl)oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol (PubChem CID 163113866) has the molecular formula C31H55BrO7 and a molecular weight of 619.68 g/mol. Its IUPAC name is 6-[5-[5-(7-bromo-2,4a,6,6,9a-pentamethyl-4,7,8,9-tetrahydro-3H-pyrano[3,2-b]oxepin-2-yl)oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol.
| Compound Name | 6-[5-[5-(7-bromo-2,4a,6,6,9a-pentamethyl-4,7,8,9-tetrahydro-3H-pyrano[3,2-b]oxepin-2-yl)oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
|---|---|
| PubChem CID | 163113866 |
| Molecular Formula | C31H55BrO7 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | 6-[5-[5-(7-bromo-2,4a,6,6,9a-pentamethyl-4,7,8,9-tetrahydro-3H-pyrano[3,2-b]oxepin-2-yl)oxolan-2-yl]-5-methyloxolan-2-yl]-2-methylheptane-2,3,6-triol |
| SMILES | CC(C)(O)C(O)CCC(C)(O)C1CCC(C)(C2CCC(C3(C)CCC4(C)OC(C)(C)C(Br)CCC4(C)O3)O2)O1 |
| InChI | InChI=1S/C31H55BrO7/c1-25(2,34)21(33)13-15-27(5,35)22-14-16-28(6,37-22)23-10-11-24(36-23)29(7)18-19-31(9)30(8,39-29)17-12-20(32)26(3,4)38-31/h20-24,33-35H,10-19H2,1-9H3 |
| InChIKey | UBZUCFVOKWMNDV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|