C13H22O4 — CID 11368493
(4S)-2,2-dimethyl-4-[(2R,5R)-2-methyl-5-[(2R)-2-methyloxiran-2-yl]oxolan-2-yl]-1,3-dioxolane (PubChem CID 11368493) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[(2R,5R)-2-methyl-5-[(2R)-2-methyloxiran-2-yl]oxolan-2-yl]-1,3-dioxolane.
| Compound Name | (4S)-2,2-dimethyl-4-[(2R,5R)-2-methyl-5-[(2R)-2-methyloxiran-2-yl]oxolan-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11368493 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[(2R,5R)-2-methyl-5-[(2R)-2-methyloxiran-2-yl]oxolan-2-yl]-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H]([C@@]2(C)CC[C@H]([C@@]3(C)CO3)O2)O1 |
| InChI | InChI=1S/C13H22O4/c1-11(2)14-7-10(16-11)12(3)6-5-9(17-12)13(4)8-15-13/h9-10H,5-8H2,1-4H3/t9-,10+,12-,13-/m1/s1 |
| InChIKey | CRUGZLGVBISWMU-LYIQGSDWSA-N |
| XLogP | 1.86 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|