C15H26O2 — CID 5024745
4,9,12,12-tetramethyl-5-oxatricyclo[8.2.0.04,6]dodecan-9-ol (PubChem CID 5024745) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 4,9,12,12-tetramethyl-5-oxatricyclo[8.2.0.04,6]dodecan-9-ol.
| Compound Name | 4,9,12,12-tetramethyl-5-oxatricyclo[8.2.0.04,6]dodecan-9-ol |
|---|---|
| PubChem CID | 5024745 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4,9,12,12-tetramethyl-5-oxatricyclo[8.2.0.04,6]dodecan-9-ol |
| SMILES | CC1(C)CC2C1CCC1(C)OC1CCC2(C)O |
| InChI | InChI=1S/C15H26O2/c1-13(2)9-11-10(13)5-8-15(4)12(17-15)6-7-14(11,3)16/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | KGYCKUADVHYVLM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|