C14H22O2 — CID 10998619
1-[(1aR,2aR,5S,5aS,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]ethanone (PubChem CID 10998619) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(1aR,2aR,5S,5aS,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]ethanone.
| Compound Name | 1-[(1aR,2aR,5S,5aS,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]ethanone |
|---|---|
| PubChem CID | 10998619 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-[(1aR,2aR,5S,5aS,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@]2(C)C[C@H]3O[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C14H22O2/c1-9(15)10-4-6-13(2)8-12-14(3,16-12)7-5-11(10)13/h10-12H,4-8H2,1-3H3/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | QSHLLSNLOSTAQD-ITGHMWBKSA-N |
| XLogP | 2.95 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|