C11H18O2 — CID 164669308
1-[(1S,2R)-2-acetyl-4,4-dimethylcyclopentyl]ethanone (PubChem CID 164669308) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-[(1S,2R)-2-acetyl-4,4-dimethylcyclopentyl]ethanone.
| Compound Name | 1-[(1S,2R)-2-acetyl-4,4-dimethylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 164669308 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-[(1S,2R)-2-acetyl-4,4-dimethylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@H]1CC(C)(C)C[C@H]1C(C)=O |
| InChI | InChI=1S/C11H18O2/c1-7(12)9-5-11(3,4)6-10(9)8(2)13/h9-10H,5-6H2,1-4H3/t9-,10+ |
| InChIKey | JUZRPBIOZCGHOZ-AOOOYVTPSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |