C20H32O3 — CID 163021625
(3E,5S)-6-[(1aR,2aS,5S,5aR,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]-2-methylhepta-3,6-diene-2,5-diol (PubChem CID 163021625) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (3E,5S)-6-[(1aR,2aS,5S,5aR,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]-2-methylhepta-3,6-diene-2,5-diol.
| Compound Name | (3E,5S)-6-[(1aR,2aS,5S,5aR,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]-2-methylhepta-3,6-diene-2,5-diol |
|---|---|
| PubChem CID | 163021625 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3E,5S)-6-[(1aR,2aS,5S,5aR,7aS)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[5,6-b]oxiren-5-yl]-2-methylhepta-3,6-diene-2,5-diol |
| SMILES | C=C([C@H]1CC[C@@]2(C)C[C@H]3O[C@@]3(C)CC[C@H]12)[C@@H](O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C20H32O3/c1-13(16(21)8-9-18(2,3)22)14-6-10-19(4)12-17-20(5,23-17)11-7-15(14)19/h8-9,14-17,21-22H,1,6-7,10-12H2,2-5H3/b9-8+/t14-,15-,16+,17-,19+,20+/m1/s1 |
| InChIKey | ZWHMNPKOSMHLTD-IICBUUCQSA-N |
| XLogP | 3.60 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|