C21H34O3 — CID 157269172
14-hydroxy-5,10,14,17,17-pentamethyl-9-oxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one (PubChem CID 157269172) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 14-hydroxy-5,10,14,17,17-pentamethyl-9-oxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one.
| Compound Name | 14-hydroxy-5,10,14,17,17-pentamethyl-9-oxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
|---|---|
| PubChem CID | 157269172 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 14-hydroxy-5,10,14,17,17-pentamethyl-9-oxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
| SMILES | CC12CCC3OC3(C)CCC3C(C)(O)C(=O)CC(CC1C2)C3(C)C |
| InChI | InChI=1S/C21H34O3/c1-18(2)13-10-14-12-19(14,3)8-7-17-20(4,24-17)9-6-15(18)21(5,23)16(22)11-13/h13-15,17,23H,6-12H2,1-5H3 |
| InChIKey | QYVGQVOROLCLPV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|