C23H36O4 — CID 143507692
[2,2-dimethyl-3-[1-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)ethenoxy]propyl] 6-methylbicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 143507692) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is [2,2-dimethyl-3-[1-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)ethenoxy]propyl] 6-methylbicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | [2,2-dimethyl-3-[1-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)ethenoxy]propyl] 6-methylbicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 143507692 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [2,2-dimethyl-3-[1-(6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)ethenoxy]propyl] 6-methylbicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | C=C(OCC(C)(C)COC(=O)C1CCC2(C)CC2C1)C1CCC2(C)OC2C1 |
| InChI | InChI=1S/C23H36O4/c1-15(16-7-9-23(5)19(11-16)27-23)25-13-21(2,3)14-26-20(24)17-6-8-22(4)12-18(22)10-17/h16-19H,1,6-14H2,2-5H3 |
| InChIKey | WSRYXSYPGORIKP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|