C19H28O3 — CID 142891159
(17R)-5,10,17-trimethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one (PubChem CID 142891159) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (17R)-5,10,17-trimethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one.
| Compound Name | (17R)-5,10,17-trimethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
|---|---|
| PubChem CID | 142891159 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (17R)-5,10,17-trimethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
| SMILES | C=C1C(=O)CC2CC3OC3(C)CCC3OC3(C)CCC1[C@@H]2C |
| InChI | InChI=1S/C19H28O3/c1-11-13-9-15(20)12(2)14(11)5-7-18(3)16(21-18)6-8-19(4)17(10-13)22-19/h11,13-14,16-17H,2,5-10H2,1,3-4H3/t11-,13?,14?,16?,17?,18?,19?/m1/s1 |
| InChIKey | MXFRVZKOUNENGA-ZILZTRJWSA-N |
| XLogP | 3.66 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|