C16H22O4 — CID 163009537
(1S,4R,6R,9E,11S)-10-(hydroxymethyl)-4,9-dimethyl-14-methylidene-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-13-one (PubChem CID 163009537) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,4R,6R,9E,11S)-10-(hydroxymethyl)-4,9-dimethyl-14-methylidene-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-13-one.
| Compound Name | (1S,4R,6R,9E,11S)-10-(hydroxymethyl)-4,9-dimethyl-14-methylidene-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-13-one |
|---|---|
| PubChem CID | 163009537 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,4R,6R,9E,11S)-10-(hydroxymethyl)-4,9-dimethyl-14-methylidene-5,12-dioxatricyclo[9.3.0.04,6]tetradec-9-en-13-one |
| SMILES | C=C1C(=O)O[C@@H]2/C(CO)=C(\C)CC[C@H]3O[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C16H22O4/c1-9-4-5-13-16(3,20-13)7-6-11-10(2)15(18)19-14(11)12(9)8-17/h11,13-14,17H,2,4-8H2,1,3H3/b12-9+/t11-,13+,14-,16+/m0/s1 |
| InChIKey | FJGDQFVJJTXOLB-SMZYVVPHSA-N |
| XLogP | 2.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|