C15H18O4 — CID 162973480
5a-(hydroxymethyl)-9-methyl-3-methylidene-3a,4,5,6,7,9b-hexahydrobenzo[g][1]benzofuran-2,8-dione (PubChem CID 162973480) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5a-(hydroxymethyl)-9-methyl-3-methylidene-3a,4,5,6,7,9b-hexahydrobenzo[g][1]benzofuran-2,8-dione.
| Compound Name | 5a-(hydroxymethyl)-9-methyl-3-methylidene-3a,4,5,6,7,9b-hexahydrobenzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 162973480 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5a-(hydroxymethyl)-9-methyl-3-methylidene-3a,4,5,6,7,9b-hexahydrobenzo[g][1]benzofuran-2,8-dione |
| SMILES | C=C1C(=O)OC2C3=C(C)C(=O)CCC3(CO)CCC12 |
| InChI | InChI=1S/C15H18O4/c1-8-10-3-5-15(7-16)6-4-11(17)9(2)12(15)13(10)19-14(8)18/h10,13,16H,1,3-7H2,2H3 |
| InChIKey | DLHNHFIJGPTSHL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|