C19H24O5 — CID 162904807
[9-(hydroxymethyl)-5a-methyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-methylprop-2-enoate (PubChem CID 162904807) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is [9-(hydroxymethyl)-5a-methyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-methylprop-2-enoate.
| Compound Name | [9-(hydroxymethyl)-5a-methyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162904807 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [9-(hydroxymethyl)-5a-methyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(CO)=C2C3OC(=O)C(=C)C3CCC21C |
| InChI | InChI=1S/C19H24O5/c1-10(2)17(21)23-14-6-5-12(9-20)15-16-13(7-8-19(14,15)4)11(3)18(22)24-16/h13-14,16,20H,1,3,5-9H2,2,4H3 |
| InChIKey | DXUUYKZZAJEBSQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|