C22H36O4 — CID 142219438
ethane;(16R)-10-methoxy-4,9,16-trimethyl-15-methylidene-5-oxatricyclo[10.3.1.04,6]hexadecane-2,14-dione (PubChem CID 142219438) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is ethane;(16R)-10-methoxy-4,9,16-trimethyl-15-methylidene-5-oxatricyclo[10.3.1.04,6]hexadecane-2,14-dione.
| Compound Name | ethane;(16R)-10-methoxy-4,9,16-trimethyl-15-methylidene-5-oxatricyclo[10.3.1.04,6]hexadecane-2,14-dione |
|---|---|
| PubChem CID | 142219438 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | ethane;(16R)-10-methoxy-4,9,16-trimethyl-15-methylidene-5-oxatricyclo[10.3.1.04,6]hexadecane-2,14-dione |
| SMILES | C=C1C(=O)CC2CC(OC)C(C)CCC3OC3(C)CC(=O)C1[C@@H]2C.CC |
| InChI | InChI=1S/C20H30O4.C2H6/c1-11-6-7-18-20(4,24-18)10-16(22)19-12(2)14(9-17(11)23-5)8-15(21)13(19)3;1-2/h11-12,14,17-19H,3,6-10H2,1-2,4-5H3;1-2H3/t11?,12-,14?,17?,18?,19?,20?;/m1./s1 |
| InChIKey | DDOZFQRPNWJUDQ-QKMKAKTFSA-N |
| XLogP | 4.36 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|