C21H30O5 — CID 163058875
[(1R,3R,5R,8S,10S,12R,13S)-5,17,17-trimethyl-14-methylidene-15-oxo-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-12-yl] acetate (PubChem CID 163058875) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1R,3R,5R,8S,10S,12R,13S)-5,17,17-trimethyl-14-methylidene-15-oxo-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-12-yl] acetate.
| Compound Name | [(1R,3R,5R,8S,10S,12R,13S)-5,17,17-trimethyl-14-methylidene-15-oxo-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-12-yl] acetate |
|---|---|
| PubChem CID | 163058875 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1R,3R,5R,8S,10S,12R,13S)-5,17,17-trimethyl-14-methylidene-15-oxo-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-12-yl] acetate |
| SMILES | C=C1C(=O)C[C@H]2C[C@H]3O[C@]3(C)CC[C@@H]3O[C@H]3C[C@@H](OC(C)=O)[C@H]1C2(C)C |
| InChI | InChI=1S/C21H30O5/c1-11-14(23)8-13-9-18-21(5,26-18)7-6-15-16(25-15)10-17(24-12(2)22)19(11)20(13,3)4/h13,15-19H,1,6-10H2,2-5H3/t13-,15-,16-,17+,18+,19-,21+/m0/s1 |
| InChIKey | ZFGJYTJLCVMBNP-QCBBCZTKSA-N |
| XLogP | 3.20 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|