About trans-(1S,2S)-1-methoxy-2-methylcyclopropane
trans-(1S,2S)-1-methoxy-2-methylcyclopropane (PubChem CID 176834458) has the molecular formula C5H10O
and a molecular weight of 86.13 g/mol. Its IUPAC name is trans-(1S,2S)-1-methoxy-2-methylcyclopropane.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-methoxy-2-methylcyclopropane |
| PubChem CID | 176834458 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | trans-(1S,2S)-1-methoxy-2-methylcyclopropane |
| SMILES | CO[C@H]1C[C@@H]1C |
| InChI | InChI=1S/C5H10O/c1-4-3-5(4)6-2/h4-5H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | FWTJMAAEPVDMQP-WHFBIAKZSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2S)-1-methoxy-2-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-methoxy-2-methylcyclopropane?
The IUPAC name of trans-(1S,2S)-1-methoxy-2-methylcyclopropane (CID 176834458) is trans-(1S,2S)-1-methoxy-2-methylcyclopropane.
What is the SMILES notation for trans-(1S,2S)-1-methoxy-2-methylcyclopropane?
The canonical SMILES for trans-(1S,2S)-1-methoxy-2-methylcyclopropane is CO[C@H]1C[C@@H]1C.
What is the InChIKey of trans-(1S,2S)-1-methoxy-2-methylcyclopropane?
The InChIKey is FWTJMAAEPVDMQP-WHFBIAKZSA-N. The full InChI is InChI=1S/C5H10O/c1-4-3-5(4)6-2/h4-5H,3H2,1-2H3/t4-,5-/m0/s1.
What are the key properties of trans-(1S,2S)-1-methoxy-2-methylcyclopropane?
trans-(1S,2S)-1-methoxy-2-methylcyclopropane has a molecular weight of 86.13 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-methoxy-2-methylcyclopropane is sourced from PubChem (CID 176834458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).