C8H16O — CID 166889412
(1S,2S,3S)-1-methoxy-2,3-dimethylcyclopentane (PubChem CID 166889412) has the molecular formula C8H16O and a molecular weight of 128.22 g/mol. Its IUPAC name is (1S,2S,3S)-1-methoxy-2,3-dimethylcyclopentane.
| Compound Name | (1S,2S,3S)-1-methoxy-2,3-dimethylcyclopentane |
|---|---|
| PubChem CID | 166889412 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (1S,2S,3S)-1-methoxy-2,3-dimethylcyclopentane |
| SMILES | CO[C@H]1CC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C8H16O/c1-6-4-5-8(9-3)7(6)2/h6-8H,4-5H2,1-3H3/t6-,7-,8-/m0/s1 |
| InChIKey | LGLRYJDFHYBMKO-FXQIFTODSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |