C9H15ClO2 — CID 10012758
[(1S,2R,3S)-2,3-dimethylcyclopentyl] 2-chloroacetate (PubChem CID 10012758) has the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. Its IUPAC name is [(1S,2R,3S)-2,3-dimethylcyclopentyl] 2-chloroacetate.
| Compound Name | [(1S,2R,3S)-2,3-dimethylcyclopentyl] 2-chloroacetate |
|---|---|
| PubChem CID | 10012758 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | [(1S,2R,3S)-2,3-dimethylcyclopentyl] 2-chloroacetate |
| SMILES | C[C@H]1[C@@H](OC(=O)CCl)CC[C@@H]1C |
| InChI | InChI=1S/C9H15ClO2/c1-6-3-4-8(7(6)2)12-9(11)5-10/h6-8H,3-5H2,1-2H3/t6-,7+,8-/m0/s1 |
| InChIKey | IDSWSONLPFFENF-RNJXMRFFSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|