C9H17NO2S2 — CID 90918290
(2,3-dimethylcyclohexyl) N,N-bis(sulfanyl)carbamate (PubChem CID 90918290) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is (2,3-dimethylcyclohexyl) N,N-bis(sulfanyl)carbamate.
| Compound Name | (2,3-dimethylcyclohexyl) N,N-bis(sulfanyl)carbamate |
|---|---|
| PubChem CID | 90918290 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (2,3-dimethylcyclohexyl) N,N-bis(sulfanyl)carbamate |
| SMILES | CC1CCCC(OC(=O)N(S)S)C1C |
| InChI | InChI=1S/C9H17NO2S2/c1-6-4-3-5-8(7(6)2)12-9(11)10(13)14/h6-8,13-14H,3-5H2,1-2H3 |
| InChIKey | MARLBPRKZKUDOH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|