C9H14ClFO2 — CID 102243983
[(1S,2S)-2-fluorocycloheptyl] 2-chloroacetate (PubChem CID 102243983) has the molecular formula C9H14ClFO2 and a molecular weight of 208.66 g/mol. Its IUPAC name is [(1S,2S)-2-fluorocycloheptyl] 2-chloroacetate.
| Compound Name | [(1S,2S)-2-fluorocycloheptyl] 2-chloroacetate |
|---|---|
| PubChem CID | 102243983 |
| Molecular Formula | C9H14ClFO2 |
| Molecular Weight | 208.66 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [(1S,2S)-2-fluorocycloheptyl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@H]1CCCCC[C@@H]1F |
| InChI | InChI=1S/C9H14ClFO2/c10-6-9(12)13-8-5-3-1-2-4-7(8)11/h7-8H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | COBMFTUQJDHIFP-YUMQZZPRSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|