C6H14O4 — CID 70486322
2,2-dimethyl-1,3-dioxolan-4-ol;methanol (PubChem CID 70486322) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolan-4-ol;methanol.
| Compound Name | 2,2-dimethyl-1,3-dioxolan-4-ol;methanol |
|---|---|
| PubChem CID | 70486322 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolan-4-ol;methanol |
| SMILES | CC1(C)OCC(O)O1.CO |
| InChI | InChI=1S/C5H10O3.CH4O/c1-5(2)7-3-4(6)8-5;1-2/h4,6H,3H2,1-2H3;2H,1H3 |
| InChIKey | NPNVLVZWYRAPHT-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |