C11H18O4 — CID 101063403
(1S,2R,6S,8R)-10,10-dimethyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol (PubChem CID 101063403) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S,2R,6S,8R)-10,10-dimethyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol.
| Compound Name | (1S,2R,6S,8R)-10,10-dimethyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol |
|---|---|
| PubChem CID | 101063403 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1S,2R,6S,8R)-10,10-dimethyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol |
| SMILES | CC1(C)OC[C@@H]2[C@H]3CC(O)O[C@H]3C[C@H]2O1 |
| InChI | InChI=1S/C11H18O4/c1-11(2)13-5-7-6-3-10(12)14-8(6)4-9(7)15-11/h6-10,12H,3-5H2,1-2H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | MKSUXNPHXZMXLM-ZKZCYXTQSA-N |
| XLogP | 0.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |