C6H10O4 — CID 10909699
2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 10909699) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 10909699 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)OCC(C(=O)O)O1 |
| InChI | InChI=1S/C6H10O4/c1-6(2)9-3-4(10-6)5(7)8/h4H,3H2,1-2H3,(H,7,8) |
| InChIKey | OZPFVBLDYBXHAF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |